C10H22N2OS — CID 77062368
4-tert-butylsulfanyl-N'-hydroxy-2,2-dimethylbutanimidamide (PubChem CID 77062368) has the molecular formula C10H22N2OS and a molecular weight of 218.37 g/mol. Its IUPAC name is 4-tert-butylsulfanyl-N'-hydroxy-2,2-dimethylbutanimidamide.
| Compound Name | 4-tert-butylsulfanyl-N'-hydroxy-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 77062368 |
| Molecular Formula | C10H22N2OS |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 4-tert-butylsulfanyl-N'-hydroxy-2,2-dimethylbutanimidamide |
| SMILES | CC(C)(C)SCCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C10H22N2OS/c1-9(2,3)14-7-6-10(4,5)8(11)12-13/h13H,6-7H2,1-5H3,(H2,11,12) |
| InChIKey | WNNBIKKMHWVPKS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|