C15H24N2O3 — CID 77063291
5-(2-ethoxyphenoxy)-N'-hydroxy-2,2-dimethylpentanimidamide (PubChem CID 77063291) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 5-(2-ethoxyphenoxy)-N'-hydroxy-2,2-dimethylpentanimidamide.
| Compound Name | 5-(2-ethoxyphenoxy)-N'-hydroxy-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 77063291 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 5-(2-ethoxyphenoxy)-N'-hydroxy-2,2-dimethylpentanimidamide |
| SMILES | CCOc1ccccc1OCCCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C15H24N2O3/c1-4-19-12-8-5-6-9-13(12)20-11-7-10-15(2,3)14(16)17-18/h5-6,8-9,18H,4,7,10-11H2,1-3H3,(H2,16,17) |
| InChIKey | QVEPOSCOZOCDOC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|