C14H19N5OS — CID 77064296
4-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)-methylamino]-N'-hydroxybenzenecarboximidamide (PubChem CID 77064296) has the molecular formula C14H19N5OS and a molecular weight of 305.41 g/mol. Its IUPAC name is 4-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)-methylamino]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)-methylamino]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 77064296 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 4-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)-methylamino]-N'-hydroxybenzenecarboximidamide |
| SMILES | CN(c1ccc(C(N)=NO)cc1)c1nc(C(C)(C)C)ns1 |
| InChI | InChI=1S/C14H19N5OS/c1-14(2,3)12-16-13(21-18-12)19(4)10-7-5-9(6-8-10)11(15)17-20/h5-8,20H,1-4H3,(H2,15,17) |
| InChIKey | ZACHLSDHXSXHCU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|