C13H20N2O2S — CID 77066115
5-(butylsulfanylmethyl)-N'-hydroxy-2-methoxybenzenecarboximidamide (PubChem CID 77066115) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 5-(butylsulfanylmethyl)-N'-hydroxy-2-methoxybenzenecarboximidamide.
| Compound Name | 5-(butylsulfanylmethyl)-N'-hydroxy-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 77066115 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 5-(butylsulfanylmethyl)-N'-hydroxy-2-methoxybenzenecarboximidamide |
| SMILES | CCCCSCc1ccc(OC)c(C(N)=NO)c1 |
| InChI | InChI=1S/C13H20N2O2S/c1-3-4-7-18-9-10-5-6-12(17-2)11(8-10)13(14)15-16/h5-6,8,16H,3-4,7,9H2,1-2H3,(H2,14,15) |
| InChIKey | ZKOLVCJLAOHXJJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|