C12H18N2OS — CID 43615814
2-(butylsulfanylmethyl)-N'-hydroxybenzenecarboximidamide (PubChem CID 43615814) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 2-(butylsulfanylmethyl)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-(butylsulfanylmethyl)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 43615814 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-(butylsulfanylmethyl)-N'-hydroxybenzenecarboximidamide |
| SMILES | CCCCSCc1ccccc1/C(N)=N/O |
| InChI | InChI=1S/C12H18N2OS/c1-2-3-8-16-9-10-6-4-5-7-11(10)12(13)14-15/h4-7,15H,2-3,8-9H2,1H3,(H2,13,14) |
| InChIKey | WVMBUDYBDPKHMW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|