C15H24N2O2 — CID 77068937
N'-hydroxy-3,5-dimethyl-4-(2-methylpentoxy)benzenecarboximidamide (PubChem CID 77068937) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is N'-hydroxy-3,5-dimethyl-4-(2-methylpentoxy)benzenecarboximidamide.
| Compound Name | N'-hydroxy-3,5-dimethyl-4-(2-methylpentoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 77068937 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | N'-hydroxy-3,5-dimethyl-4-(2-methylpentoxy)benzenecarboximidamide |
| SMILES | CCCC(C)COc1c(C)cc(C(N)=NO)cc1C |
| InChI | InChI=1S/C15H24N2O2/c1-5-6-10(2)9-19-14-11(3)7-13(8-12(14)4)15(16)17-18/h7-8,10,18H,5-6,9H2,1-4H3,(H2,16,17) |
| InChIKey | YMQYAMUTQDDEMW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|