C15H14N2O4 — CID 77070299
3-[3-[(3,4-dimethyl-1,2-oxazol-5-yl)carbamoyl]phenyl]prop-2-enoic acid (PubChem CID 77070299) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 3-[3-[(3,4-dimethyl-1,2-oxazol-5-yl)carbamoyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[(3,4-dimethyl-1,2-oxazol-5-yl)carbamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77070299 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-[3-[(3,4-dimethyl-1,2-oxazol-5-yl)carbamoyl]phenyl]prop-2-enoic acid |
| SMILES | Cc1noc(NC(=O)c2cccc(C=CC(=O)O)c2)c1C |
| InChI | InChI=1S/C15H14N2O4/c1-9-10(2)17-21-15(9)16-14(20)12-5-3-4-11(8-12)6-7-13(18)19/h3-8H,1-2H3,(H,16,20)(H,18,19) |
| InChIKey | CGGZKQQRRLPKET-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|