C12H15BrClN3O — CID 77070556
2-[1-[(5-bromo-2-chloroanilino)methyl]cyclopropyl]-N'-hydroxyethanimidamide (PubChem CID 77070556) has the molecular formula C12H15BrClN3O and a molecular weight of 332.63 g/mol. Its IUPAC name is 2-[1-[(5-bromo-2-chloroanilino)methyl]cyclopropyl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[1-[(5-bromo-2-chloroanilino)methyl]cyclopropyl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 77070556 |
| Molecular Formula | C12H15BrClN3O |
| Molecular Weight | 332.63 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 2-[1-[(5-bromo-2-chloroanilino)methyl]cyclopropyl]-N'-hydroxyethanimidamide |
| SMILES | NC(CC1(CNc2cc(Br)ccc2Cl)CC1)=NO |
| InChI | InChI=1S/C12H15BrClN3O/c13-8-1-2-9(14)10(5-8)16-7-12(3-4-12)6-11(15)17-18/h1-2,5,16,18H,3-4,6-7H2,(H2,15,17) |
| InChIKey | JGWHSZGGJVOCGF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.63 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|