C13H17ClFN3O — CID 77070910
2-[1-[[(3-chloro-4-fluorophenyl)methylamino]methyl]cyclopropyl]-N'-hydroxyethanimidamide (PubChem CID 77070910) has the molecular formula C13H17ClFN3O and a molecular weight of 285.75 g/mol. Its IUPAC name is 2-[1-[[(3-chloro-4-fluorophenyl)methylamino]methyl]cyclopropyl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[1-[[(3-chloro-4-fluorophenyl)methylamino]methyl]cyclopropyl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 77070910 |
| Molecular Formula | C13H17ClFN3O |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-[1-[[(3-chloro-4-fluorophenyl)methylamino]methyl]cyclopropyl]-N'-hydroxyethanimidamide |
| SMILES | NC(CC1(CNCc2ccc(F)c(Cl)c2)CC1)=NO |
| InChI | InChI=1S/C13H17ClFN3O/c14-10-5-9(1-2-11(10)15)7-17-8-13(3-4-13)6-12(16)18-19/h1-2,5,17,19H,3-4,6-8H2,(H2,16,18) |
| InChIKey | NUTPQCCZZIHYCL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|