C14H29N5O — CID 77071581
2-[1-[[4-[2-(dimethylamino)ethyl]piperazin-1-yl]methyl]cyclopropyl]-N'-hydroxyethanimidamide (PubChem CID 77071581) has the molecular formula C14H29N5O and a molecular weight of 283.42 g/mol. Its IUPAC name is 2-[1-[[4-[2-(dimethylamino)ethyl]piperazin-1-yl]methyl]cyclopropyl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[1-[[4-[2-(dimethylamino)ethyl]piperazin-1-yl]methyl]cyclopropyl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 77071581 |
| Molecular Formula | C14H29N5O |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.24 |
| IUPAC Name | 2-[1-[[4-[2-(dimethylamino)ethyl]piperazin-1-yl]methyl]cyclopropyl]-N'-hydroxyethanimidamide |
| SMILES | CN(C)CCN1CCN(CC2(CC(N)=NO)CC2)CC1 |
| InChI | InChI=1S/C14H29N5O/c1-17(2)5-6-18-7-9-19(10-8-18)12-14(3-4-14)11-13(15)16-20/h20H,3-12H2,1-2H3,(H2,15,16) |
| InChIKey | VLHHJXQEOHZALK-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|