C15H25N3O3 — CID 77073448
3-[2-(2-ethoxyphenoxy)ethyl-methylamino]-N'-hydroxybutanimidamide (PubChem CID 77073448) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 3-[2-(2-ethoxyphenoxy)ethyl-methylamino]-N'-hydroxybutanimidamide.
| Compound Name | 3-[2-(2-ethoxyphenoxy)ethyl-methylamino]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 77073448 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 3-[2-(2-ethoxyphenoxy)ethyl-methylamino]-N'-hydroxybutanimidamide |
| SMILES | CCOc1ccccc1OCCN(C)C(C)CC(N)=NO |
| InChI | InChI=1S/C15H25N3O3/c1-4-20-13-7-5-6-8-14(13)21-10-9-18(3)12(2)11-15(16)17-19/h5-8,12,19H,4,9-11H2,1-3H3,(H2,16,17) |
| InChIKey | WYOVAOWPXDQPHD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|