C12H20N2O3 — CID 77074383
methyl 4-(4-carbamoylpiperidin-1-yl)-2-methylbut-2-enoate (PubChem CID 77074383) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is methyl 4-(4-carbamoylpiperidin-1-yl)-2-methylbut-2-enoate.
| Compound Name | methyl 4-(4-carbamoylpiperidin-1-yl)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 77074383 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | methyl 4-(4-carbamoylpiperidin-1-yl)-2-methylbut-2-enoate |
| SMILES | COC(=O)C(C)=CCN1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C12H20N2O3/c1-9(12(16)17-2)3-6-14-7-4-10(5-8-14)11(13)15/h3,10H,4-8H2,1-2H3,(H2,13,15) |
| InChIKey | PKZMGPYVPOGSBD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|