C16H26N2O4 — CID 90675744
methyl (E)-4-[[1-(3-methylbutanoyl)piperidine-4-carbonyl]amino]but-2-enoate (PubChem CID 90675744) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is methyl (E)-4-[[1-(3-methylbutanoyl)piperidine-4-carbonyl]amino]but-2-enoate.
| Compound Name | methyl (E)-4-[[1-(3-methylbutanoyl)piperidine-4-carbonyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 90675744 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | methyl (E)-4-[[1-(3-methylbutanoyl)piperidine-4-carbonyl]amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)C1CCN(C(=O)CC(C)C)CC1 |
| InChI | InChI=1S/C16H26N2O4/c1-12(2)11-14(19)18-9-6-13(7-10-18)16(21)17-8-4-5-15(20)22-3/h4-5,12-13H,6-11H2,1-3H3,(H,17,21)/b5-4+ |
| InChIKey | PANCJFCTQIQVDD-SNAWJCMRSA-N |
| XLogP | 1.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|