C16H24N2O4 — CID 118667821
methyl (E)-4-[(1-cyclopentyl-6-oxopiperidine-3-carbonyl)amino]but-2-enoate (PubChem CID 118667821) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is methyl (E)-4-[(1-cyclopentyl-6-oxopiperidine-3-carbonyl)amino]but-2-enoate.
| Compound Name | methyl (E)-4-[(1-cyclopentyl-6-oxopiperidine-3-carbonyl)amino]but-2-enoate |
|---|---|
| PubChem CID | 118667821 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | methyl (E)-4-[(1-cyclopentyl-6-oxopiperidine-3-carbonyl)amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)C1CCC(=O)N(C2CCCC2)C1 |
| InChI | InChI=1S/C16H24N2O4/c1-22-15(20)7-4-10-17-16(21)12-8-9-14(19)18(11-12)13-5-2-3-6-13/h4,7,12-13H,2-3,5-6,8-11H2,1H3,(H,17,21)/b7-4+ |
| InChIKey | ZNUYFUJYQPHDDQ-QPJJXVBHSA-N |
| XLogP | 1.01 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|