C19H25N3O2S — CID 77079060
N-(2-methoxyethyl)-1-pyridin-2-yl-N-(thiophen-3-ylmethyl)piperidine-3-carboxamide (PubChem CID 77079060) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-pyridin-2-yl-N-(thiophen-3-ylmethyl)piperidine-3-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1-pyridin-2-yl-N-(thiophen-3-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 77079060 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-(2-methoxyethyl)-1-pyridin-2-yl-N-(thiophen-3-ylmethyl)piperidine-3-carboxamide |
| SMILES | COCCN(Cc1ccsc1)C(=O)C1CCCN(c2ccccn2)C1 |
| InChI | InChI=1S/C19H25N3O2S/c1-24-11-10-22(13-16-7-12-25-15-16)19(23)17-5-4-9-21(14-17)18-6-2-3-8-20-18/h2-3,6-8,12,15,17H,4-5,9-11,13-14H2,1H3 |
| InChIKey | LKMBWBYYHTYLSD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |