About 5-chloro-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N,2-dimethylbenzamide
5-chloro-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N,2-dimethylbenzamide (PubChem CID 77079296) has the molecular formula C16H20ClN3O
and a molecular weight of 305.81 g/mol. Its IUPAC name is 5-chloro-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N,2-dimethylbenzamide.
Molecular Properties
| Compound Name | 5-chloro-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N,2-dimethylbenzamide |
| PubChem CID | 77079296 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 5-chloro-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N,2-dimethylbenzamide |
| SMILES | Cc1ccc(Cl)cc1C(=O)N(C)CCc1c(C)n[nH]c1C |
| InChI | InChI=1S/C16H20ClN3O/c1-10-5-6-13(17)9-15(10)16(21)20(4)8-7-14-11(2)18-19-12(14)3/h5-6,9H,7-8H2,1-4H3,(H,18,19) |
| InChIKey | CTFNUKZXLSHHJB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N,2-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N,2-dimethylbenzamide?
The IUPAC name of 5-chloro-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N,2-dimethylbenzamide (CID 77079296) is 5-chloro-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N,2-dimethylbenzamide.
What is the SMILES notation for 5-chloro-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N,2-dimethylbenzamide?
The canonical SMILES for 5-chloro-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N,2-dimethylbenzamide is Cc1ccc(Cl)cc1C(=O)N(C)CCc1c(C)n[nH]c1C.
What is the InChIKey of 5-chloro-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N,2-dimethylbenzamide?
The InChIKey is CTFNUKZXLSHHJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClN3O/c1-10-5-6-13(17)9-15(10)16(21)20(4)8-7-14-11(2)18-19-12(14)3/h5-6,9H,7-8H2,1-4H3,(H,18,19).
What are the key properties of 5-chloro-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N,2-dimethylbenzamide?
5-chloro-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N,2-dimethylbenzamide has a molecular weight of 305.81 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N,2-dimethylbenzamide is sourced from PubChem (CID 77079296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).