About 3-amino-4-chloro-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-N-methyl-1H-pyrazole-5-carboxamide
3-amino-4-chloro-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-N-methyl-1H-pyrazole-5-carboxamide (PubChem CID 90647926) has the molecular formula C13H19ClN6O
and a molecular weight of 310.79 g/mol. Its IUPAC name is 3-amino-4-chloro-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-N-methyl-1H-pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-amino-4-chloro-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-N-methyl-1H-pyrazole-5-carboxamide |
| PubChem CID | 90647926 |
| Molecular Formula | C13H19ClN6O |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 3-amino-4-chloro-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-N-methyl-1H-pyrazole-5-carboxamide |
| SMILES | Cc1n[nH]c(C)c1CCCN(C)C(=O)c1[nH]nc(N)c1Cl |
| InChI | InChI=1S/C13H19ClN6O/c1-7-9(8(2)17-16-7)5-4-6-20(3)13(21)11-10(14)12(15)19-18-11/h4-6H2,1-3H3,(H,16,17)(H3,15,18,19) |
| InChIKey | SWIDXLIIOBFERF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-4-chloro-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-N-methyl-1H-pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-chloro-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-N-methyl-1H-pyrazole-5-carboxamide?
The IUPAC name of 3-amino-4-chloro-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-N-methyl-1H-pyrazole-5-carboxamide (CID 90647926) is 3-amino-4-chloro-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-N-methyl-1H-pyrazole-5-carboxamide.
What is the SMILES notation for 3-amino-4-chloro-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-N-methyl-1H-pyrazole-5-carboxamide?
The canonical SMILES for 3-amino-4-chloro-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-N-methyl-1H-pyrazole-5-carboxamide is Cc1n[nH]c(C)c1CCCN(C)C(=O)c1[nH]nc(N)c1Cl.
What is the InChIKey of 3-amino-4-chloro-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-N-methyl-1H-pyrazole-5-carboxamide?
The InChIKey is SWIDXLIIOBFERF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19ClN6O/c1-7-9(8(2)17-16-7)5-4-6-20(3)13(21)11-10(14)12(15)19-18-11/h4-6H2,1-3H3,(H,16,17)(H3,15,18,19).
What are the key properties of 3-amino-4-chloro-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-N-methyl-1H-pyrazole-5-carboxamide?
3-amino-4-chloro-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-N-methyl-1H-pyrazole-5-carboxamide has a molecular weight of 310.79 g/mol, XLogP of 1.69, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-chloro-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-N-methyl-1H-pyrazole-5-carboxamide is sourced from PubChem (CID 90647926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).