C15H18ClN3O3 — CID 77080664
2-[4-chloro-2-[[methyl(2-pyrazol-1-ylethyl)amino]methyl]phenoxy]acetic acid (PubChem CID 77080664) has the molecular formula C15H18ClN3O3 and a molecular weight of 323.78 g/mol. Its IUPAC name is 2-[4-chloro-2-[[methyl(2-pyrazol-1-ylethyl)amino]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-chloro-2-[[methyl(2-pyrazol-1-ylethyl)amino]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 77080664 |
| Molecular Formula | C15H18ClN3O3 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-[4-chloro-2-[[methyl(2-pyrazol-1-ylethyl)amino]methyl]phenoxy]acetic acid |
| SMILES | CN(CCn1cccn1)Cc1cc(Cl)ccc1OCC(=O)O |
| InChI | InChI=1S/C15H18ClN3O3/c1-18(7-8-19-6-2-5-17-19)10-12-9-13(16)3-4-14(12)22-11-15(20)21/h2-6,9H,7-8,10-11H2,1H3,(H,20,21) |
| InChIKey | VQWAYUQMWMCZBZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |