C17H27N3O — CID 77080780
1-[(2,2-dimethyloxan-4-yl)methyl]-4-pyridin-3-ylpiperazine (PubChem CID 77080780) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-[(2,2-dimethyloxan-4-yl)methyl]-4-pyridin-3-ylpiperazine.
| Compound Name | 1-[(2,2-dimethyloxan-4-yl)methyl]-4-pyridin-3-ylpiperazine |
|---|---|
| PubChem CID | 77080780 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 1-[(2,2-dimethyloxan-4-yl)methyl]-4-pyridin-3-ylpiperazine |
| SMILES | CC1(C)CC(CN2CCN(c3cccnc3)CC2)CCO1 |
| InChI | InChI=1S/C17H27N3O/c1-17(2)12-15(5-11-21-17)14-19-7-9-20(10-8-19)16-4-3-6-18-13-16/h3-4,6,13,15H,5,7-12,14H2,1-2H3 |
| InChIKey | PXXZBNKFYMPLBP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |