C17H21ClN2O — CID 77080814
N-[(6-chloroquinolin-2-yl)methyl]-N-methyl-1-(oxan-2-yl)methanamine (PubChem CID 77080814) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is N-[(6-chloroquinolin-2-yl)methyl]-N-methyl-1-(oxan-2-yl)methanamine.
| Compound Name | N-[(6-chloroquinolin-2-yl)methyl]-N-methyl-1-(oxan-2-yl)methanamine |
|---|---|
| PubChem CID | 77080814 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N-[(6-chloroquinolin-2-yl)methyl]-N-methyl-1-(oxan-2-yl)methanamine |
| SMILES | CN(Cc1ccc2cc(Cl)ccc2n1)CC1CCCCO1 |
| InChI | InChI=1S/C17H21ClN2O/c1-20(12-16-4-2-3-9-21-16)11-15-7-5-13-10-14(18)6-8-17(13)19-15/h5-8,10,16H,2-4,9,11-12H2,1H3 |
| InChIKey | YJSHHFDFEYHPJX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |