C14H17ClN2O2 — CID 99928103
(2S)-3-[(6-chloroquinolin-2-yl)methyl-methylamino]propane-1,2-diol (PubChem CID 99928103) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.76 g/mol. Its IUPAC name is (2S)-3-[(6-chloroquinolin-2-yl)methyl-methylamino]propane-1,2-diol.
| Compound Name | (2S)-3-[(6-chloroquinolin-2-yl)methyl-methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 99928103 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | (2S)-3-[(6-chloroquinolin-2-yl)methyl-methylamino]propane-1,2-diol |
| SMILES | CN(Cc1ccc2cc(Cl)ccc2n1)C[C@H](O)CO |
| InChI | InChI=1S/C14H17ClN2O2/c1-17(8-13(19)9-18)7-12-4-2-10-6-11(15)3-5-14(10)16-12/h2-6,13,18-19H,7-9H2,1H3/t13-/m0/s1 |
| InChIKey | XTZRZGUIKZCUJA-ZDUSSCGKSA-N |
| XLogP | 1.67 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |