C18H24N4O2 — CID 77080984
[4-[[2-(2-methoxyphenyl)pyrimidin-5-yl]methyl]-1-methylpiperazin-2-yl]methanol (PubChem CID 77080984) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is [4-[[2-(2-methoxyphenyl)pyrimidin-5-yl]methyl]-1-methylpiperazin-2-yl]methanol.
| Compound Name | [4-[[2-(2-methoxyphenyl)pyrimidin-5-yl]methyl]-1-methylpiperazin-2-yl]methanol |
|---|---|
| PubChem CID | 77080984 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [4-[[2-(2-methoxyphenyl)pyrimidin-5-yl]methyl]-1-methylpiperazin-2-yl]methanol |
| SMILES | COc1ccccc1-c1ncc(CN2CCN(C)C(CO)C2)cn1 |
| InChI | InChI=1S/C18H24N4O2/c1-21-7-8-22(12-15(21)13-23)11-14-9-19-18(20-10-14)16-5-3-4-6-17(16)24-2/h3-6,9-10,15,23H,7-8,11-13H2,1-2H3 |
| InChIKey | ZKTRLPXXODBYTG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |