C17H23N3O — CID 39818455
2-[(2S)-1-methyl-4-(quinolin-3-ylmethyl)piperazin-2-yl]ethanol (PubChem CID 39818455) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-[(2S)-1-methyl-4-(quinolin-3-ylmethyl)piperazin-2-yl]ethanol.
| Compound Name | 2-[(2S)-1-methyl-4-(quinolin-3-ylmethyl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 39818455 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 2-[(2S)-1-methyl-4-(quinolin-3-ylmethyl)piperazin-2-yl]ethanol |
| SMILES | CN1CCN(Cc2cnc3ccccc3c2)C[C@@H]1CCO |
| InChI | InChI=1S/C17H23N3O/c1-19-7-8-20(13-16(19)6-9-21)12-14-10-15-4-2-3-5-17(15)18-11-14/h2-5,10-11,16,21H,6-9,12-13H2,1H3/t16-/m0/s1 |
| InChIKey | MVEZTQYXRCNDJW-INIZCTEOSA-N |
| XLogP | 1.73 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |