C16H22N2OS — CID 29088518
2-[(2S)-4-(1-benzothiophen-5-ylmethyl)-1-methylpiperazin-2-yl]ethanol (PubChem CID 29088518) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-[(2S)-4-(1-benzothiophen-5-ylmethyl)-1-methylpiperazin-2-yl]ethanol.
| Compound Name | 2-[(2S)-4-(1-benzothiophen-5-ylmethyl)-1-methylpiperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 29088518 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-[(2S)-4-(1-benzothiophen-5-ylmethyl)-1-methylpiperazin-2-yl]ethanol |
| SMILES | CN1CCN(Cc2ccc3sccc3c2)C[C@@H]1CCO |
| InChI | InChI=1S/C16H22N2OS/c1-17-6-7-18(12-15(17)4-8-19)11-13-2-3-16-14(10-13)5-9-20-16/h2-3,5,9-10,15,19H,4,6-8,11-12H2,1H3/t15-/m0/s1 |
| InChIKey | MNBKRSALNZMUIK-HNNXBMFYSA-N |
| XLogP | 2.40 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |