C22H27N3OS — CID 95869483
2-[(2R)-1-methyl-4-[(7-methyl-2-thiophen-2-ylquinolin-3-yl)methyl]piperazin-2-yl]ethanol (PubChem CID 95869483) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is 2-[(2R)-1-methyl-4-[(7-methyl-2-thiophen-2-ylquinolin-3-yl)methyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[(2R)-1-methyl-4-[(7-methyl-2-thiophen-2-ylquinolin-3-yl)methyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 95869483 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-[(2R)-1-methyl-4-[(7-methyl-2-thiophen-2-ylquinolin-3-yl)methyl]piperazin-2-yl]ethanol |
| SMILES | Cc1ccc2cc(CN3CCN(C)[C@H](CCO)C3)c(-c3cccs3)nc2c1 |
| InChI | InChI=1S/C22H27N3OS/c1-16-5-6-17-13-18(14-25-9-8-24(2)19(15-25)7-10-26)22(23-20(17)12-16)21-4-3-11-27-21/h3-6,11-13,19,26H,7-10,14-15H2,1-2H3/t19-/m1/s1 |
| InChIKey | RVLXILOWCVRNJJ-LJQANCHMSA-N |
| XLogP | 3.77 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |