C18H26N4O — CID 124852713
2-[(2R)-4-[(3-benzylimidazol-4-yl)methyl]-1-methylpiperazin-2-yl]ethanol (PubChem CID 124852713) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-[(2R)-4-[(3-benzylimidazol-4-yl)methyl]-1-methylpiperazin-2-yl]ethanol.
| Compound Name | 2-[(2R)-4-[(3-benzylimidazol-4-yl)methyl]-1-methylpiperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 124852713 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 2-[(2R)-4-[(3-benzylimidazol-4-yl)methyl]-1-methylpiperazin-2-yl]ethanol |
| SMILES | CN1CCN(Cc2cncn2Cc2ccccc2)C[C@H]1CCO |
| InChI | InChI=1S/C18H26N4O/c1-20-8-9-21(13-17(20)7-10-23)14-18-11-19-15-22(18)12-16-5-3-2-4-6-16/h2-6,11,15,17,23H,7-10,12-14H2,1H3/t17-/m1/s1 |
| InChIKey | VHJLAPMTNJPINL-QGZVFWFLSA-N |
| XLogP | 1.43 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |