C19H19N3O3S — CID 77081152
N,N-dimethyl-3-(quinolin-4-ylmethylsulfamoyl)benzamide (PubChem CID 77081152) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is N,N-dimethyl-3-(quinolin-4-ylmethylsulfamoyl)benzamide.
| Compound Name | N,N-dimethyl-3-(quinolin-4-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 77081152 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N,N-dimethyl-3-(quinolin-4-ylmethylsulfamoyl)benzamide |
| SMILES | CN(C)C(=O)c1cccc(S(=O)(=O)NCc2ccnc3ccccc23)c1 |
| InChI | InChI=1S/C19H19N3O3S/c1-22(2)19(23)14-6-5-7-16(12-14)26(24,25)21-13-15-10-11-20-18-9-4-3-8-17(15)18/h3-12,21H,13H2,1-2H3 |
| InChIKey | QCVQITYYELRRNF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |