C17H22N4O3S — CID 77082477
N,N-dimethyl-3-[2-[(3-methyl-2-pyridinyl)amino]ethylsulfamoyl]benzamide (PubChem CID 77082477) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is N,N-dimethyl-3-[2-[(3-methyl-2-pyridinyl)amino]ethylsulfamoyl]benzamide.
| Compound Name | N,N-dimethyl-3-[2-[(3-methyl-2-pyridinyl)amino]ethylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 77082477 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N,N-dimethyl-3-[2-[(3-methyl-2-pyridinyl)amino]ethylsulfamoyl]benzamide |
| SMILES | Cc1cccnc1NCCNS(=O)(=O)c1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C17H22N4O3S/c1-13-6-5-9-18-16(13)19-10-11-20-25(23,24)15-8-4-7-14(12-15)17(22)21(2)3/h4-9,12,20H,10-11H2,1-3H3,(H,18,19) |
| InChIKey | ZRRIIDYWKVZMAT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|