C21H23N3O2 — CID 77081979
4-(2-methoxyphenyl)-N-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]benzamide (PubChem CID 77081979) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-N-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]benzamide.
| Compound Name | 4-(2-methoxyphenyl)-N-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 77081979 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 4-(2-methoxyphenyl)-N-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]benzamide |
| SMILES | COc1ccccc1-c1ccc(C(=O)N(C)CCc2cnn(C)c2)cc1 |
| InChI | InChI=1S/C21H23N3O2/c1-23(13-12-16-14-22-24(2)15-16)21(25)18-10-8-17(9-11-18)19-6-4-5-7-20(19)26-3/h4-11,14-15H,12-13H2,1-3H3 |
| InChIKey | DLLNKGVMKGMJHA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |