C20H23NO4 — CID 91798105
N-ethyl-N-[(3S,4R)-4-hydroxyoxolan-3-yl]-4-(2-methoxyphenyl)benzamide (PubChem CID 91798105) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-ethyl-N-[(3S,4R)-4-hydroxyoxolan-3-yl]-4-(2-methoxyphenyl)benzamide.
| Compound Name | N-ethyl-N-[(3S,4R)-4-hydroxyoxolan-3-yl]-4-(2-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 91798105 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | N-ethyl-N-[(3S,4R)-4-hydroxyoxolan-3-yl]-4-(2-methoxyphenyl)benzamide |
| SMILES | CCN(C(=O)c1ccc(-c2ccccc2OC)cc1)[C@H]1COC[C@@H]1O |
| InChI | InChI=1S/C20H23NO4/c1-3-21(17-12-25-13-18(17)22)20(23)15-10-8-14(9-11-15)16-6-4-5-7-19(16)24-2/h4-11,17-18,22H,3,12-13H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | XYOVRMOXQNZNGT-ROUUACIJSA-N |
| XLogP | 2.58 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |