C24H28N3O3+ — CID 7708519
(2'S,3R,8'S)-N-(4-methoxyphenyl)-5,7-dimethyl-2-oxospiro[1H-indole-3,3'-2,4,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium]-2'-carboxamide (PubChem CID 7708519) has the molecular formula C24H28N3O3+ and a molecular weight of 406.51 g/mol. Its IUPAC name is (2'S,3R,8'S)-N-(4-methoxyphenyl)-5,7-dimethyl-2-oxospiro[1H-indole-3,3'-2,4,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium]-2'-carboxamide.
| Compound Name | (2'S,3R,8'S)-N-(4-methoxyphenyl)-5,7-dimethyl-2-oxospiro[1H-indole-3,3'-2,4,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium]-2'-carboxamide |
|---|---|
| PubChem CID | 7708519 |
| Molecular Formula | C24H28N3O3+ |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | (2'S,3R,8'S)-N-(4-methoxyphenyl)-5,7-dimethyl-2-oxospiro[1H-indole-3,3'-2,4,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium]-2'-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@H]2C[C@@H]3CCC[NH+]3[C@]23C(=O)Nc2c(C)cc(C)cc23)cc1 |
| InChI | InChI=1S/C24H27N3O3/c1-14-11-15(2)21-19(12-14)24(23(29)26-21)20(13-17-5-4-10-27(17)24)22(28)25-16-6-8-18(30-3)9-7-16/h6-9,11-12,17,20H,4-5,10,13H2,1-3H3,(H,25,28)(H,26,29)/p+1/t17-,20+,24-/m0/s1 |
| InChIKey | YVUFEZLYZUOAFD-IQOKHDRSSA-O |
| XLogP | 2.17 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |