C17H26N4S — CID 77085871
2-imidazol-1-yl-N-methyl-N-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]ethanamine (PubChem CID 77085871) has the molecular formula C17H26N4S and a molecular weight of 318.49 g/mol. Its IUPAC name is 2-imidazol-1-yl-N-methyl-N-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]ethanamine.
| Compound Name | 2-imidazol-1-yl-N-methyl-N-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 77085871 |
| Molecular Formula | C17H26N4S |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2-imidazol-1-yl-N-methyl-N-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]ethanamine |
| SMILES | CN(CCn1ccnc1)Cc1cc(CN2CCCCC2)cs1 |
| InChI | InChI=1S/C17H26N4S/c1-19(9-10-21-8-5-18-15-21)13-17-11-16(14-22-17)12-20-6-3-2-4-7-20/h5,8,11,14-15H,2-4,6-7,9-10,12-13H2,1H3 |
| InChIKey | JESZMQXPRRFZJA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |