C21H24N4O — CID 77085937
1-[(4-phenylmethoxyphenyl)methyl]-3-(1H-1,2,4-triazol-5-yl)piperidine (PubChem CID 77085937) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-[(4-phenylmethoxyphenyl)methyl]-3-(1H-1,2,4-triazol-5-yl)piperidine.
| Compound Name | 1-[(4-phenylmethoxyphenyl)methyl]-3-(1H-1,2,4-triazol-5-yl)piperidine |
|---|---|
| PubChem CID | 77085937 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-[(4-phenylmethoxyphenyl)methyl]-3-(1H-1,2,4-triazol-5-yl)piperidine |
| SMILES | c1ccc(COc2ccc(CN3CCCC(c4ncn[nH]4)C3)cc2)cc1 |
| InChI | InChI=1S/C21H24N4O/c1-2-5-18(6-3-1)15-26-20-10-8-17(9-11-20)13-25-12-4-7-19(14-25)21-22-16-23-24-21/h1-3,5-6,8-11,16,19H,4,7,12-15H2,(H,22,23,24) |
| InChIKey | ZFMPYIRTMIRBFL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |