C19H26N4O — CID 77086173
1-[(3-cyclopentyloxyphenyl)methyl]-3-(1H-1,2,4-triazol-5-yl)piperidine (PubChem CID 77086173) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-[(3-cyclopentyloxyphenyl)methyl]-3-(1H-1,2,4-triazol-5-yl)piperidine.
| Compound Name | 1-[(3-cyclopentyloxyphenyl)methyl]-3-(1H-1,2,4-triazol-5-yl)piperidine |
|---|---|
| PubChem CID | 77086173 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 1-[(3-cyclopentyloxyphenyl)methyl]-3-(1H-1,2,4-triazol-5-yl)piperidine |
| SMILES | c1cc(CN2CCCC(c3ncn[nH]3)C2)cc(OC2CCCC2)c1 |
| InChI | InChI=1S/C19H26N4O/c1-2-8-17(7-1)24-18-9-3-5-15(11-18)12-23-10-4-6-16(13-23)19-20-14-21-22-19/h3,5,9,11,14,16-17H,1-2,4,6-8,10,12-13H2,(H,20,21,22) |
| InChIKey | BDHVQGKNDWWYSY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |