C21H23N5O2 — CID 124861052
N-(3-phenoxyphenyl)-2-[(3R)-3-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]acetamide (PubChem CID 124861052) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is N-(3-phenoxyphenyl)-2-[(3R)-3-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]acetamide.
| Compound Name | N-(3-phenoxyphenyl)-2-[(3R)-3-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 124861052 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-(3-phenoxyphenyl)-2-[(3R)-3-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC[C@@H](c2ncn[nH]2)C1)Nc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C21H23N5O2/c27-20(14-26-11-5-6-16(13-26)21-22-15-23-25-21)24-17-7-4-10-19(12-17)28-18-8-2-1-3-9-18/h1-4,7-10,12,15-16H,5-6,11,13-14H2,(H,24,27)(H,22,23,25)/t16-/m1/s1 |
| InChIKey | FUTKMIKYMLKKQW-MRXNPFEDSA-N |
| XLogP | 3.42 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |