C19H22N4O3 — CID 77087086
3-(1,3-benzodioxol-5-yl)-N-(1-pyrazin-2-ylpiperidin-3-yl)propanamide (PubChem CID 77087086) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-(1-pyrazin-2-ylpiperidin-3-yl)propanamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-(1-pyrazin-2-ylpiperidin-3-yl)propanamide |
|---|---|
| PubChem CID | 77087086 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-(1-pyrazin-2-ylpiperidin-3-yl)propanamide |
| SMILES | O=C(CCc1ccc2c(c1)OCO2)NC1CCCN(c2cnccn2)C1 |
| InChI | InChI=1S/C19H22N4O3/c24-19(6-4-14-3-5-16-17(10-14)26-13-25-16)22-15-2-1-9-23(12-15)18-11-20-7-8-21-18/h3,5,7-8,10-11,15H,1-2,4,6,9,12-13H2,(H,22,24) |
| InChIKey | NTWOZRGUSRZDSI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |