C17H20N4O3 — CID 99974790
(6S)-1-(1,3-benzodioxol-5-ylmethyl)-4-pyrazin-2-yl-1,4-diazepan-6-ol (PubChem CID 99974790) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is (6S)-1-(1,3-benzodioxol-5-ylmethyl)-4-pyrazin-2-yl-1,4-diazepan-6-ol.
| Compound Name | (6S)-1-(1,3-benzodioxol-5-ylmethyl)-4-pyrazin-2-yl-1,4-diazepan-6-ol |
|---|---|
| PubChem CID | 99974790 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (6S)-1-(1,3-benzodioxol-5-ylmethyl)-4-pyrazin-2-yl-1,4-diazepan-6-ol |
| SMILES | O[C@H]1CN(Cc2ccc3c(c2)OCO3)CCN(c2cnccn2)C1 |
| InChI | InChI=1S/C17H20N4O3/c22-14-10-20(5-6-21(11-14)17-8-18-3-4-19-17)9-13-1-2-15-16(7-13)24-12-23-15/h1-4,7-8,14,22H,5-6,9-12H2/t14-/m0/s1 |
| InChIKey | WYCDZILBOQBRBS-AWEZNQCLSA-N |
| XLogP | 0.89 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |