C11H16N6OS2 — CID 77087722
N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 77087722) has the molecular formula C11H16N6OS2 and a molecular weight of 312.42 g/mol. Its IUPAC name is N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 77087722 |
| Molecular Formula | C11H16N6OS2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | Cn1ccnc1SCCNC(=O)CSc1nncn1C |
| InChI | InChI=1S/C11H16N6OS2/c1-16-5-3-13-10(16)19-6-4-12-9(18)7-20-11-15-14-8-17(11)2/h3,5,8H,4,6-7H2,1-2H3,(H,12,18) |
| InChIKey | OIYMBZXSSWKDSY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|