C16H20F3N3 — CID 77090966
N-methyl-N-[(3-propan-2-ylimidazol-4-yl)methyl]-1-[3-(trifluoromethyl)phenyl]methanamine (PubChem CID 77090966) has the molecular formula C16H20F3N3 and a molecular weight of 311.35 g/mol. Its IUPAC name is N-methyl-N-[(3-propan-2-ylimidazol-4-yl)methyl]-1-[3-(trifluoromethyl)phenyl]methanamine.
| Compound Name | N-methyl-N-[(3-propan-2-ylimidazol-4-yl)methyl]-1-[3-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 77090966 |
| Molecular Formula | C16H20F3N3 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-methyl-N-[(3-propan-2-ylimidazol-4-yl)methyl]-1-[3-(trifluoromethyl)phenyl]methanamine |
| SMILES | CC(C)n1cncc1CN(C)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H20F3N3/c1-12(2)22-11-20-8-15(22)10-21(3)9-13-5-4-6-14(7-13)16(17,18)19/h4-8,11-12H,9-10H2,1-3H3 |
| InChIKey | USLVLCTVHVIGFV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |