C13H19F3N+ — CID 175261981
N-ethyl-N-methyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;hydron (PubChem CID 175261981) has the molecular formula C13H19F3N+ and a molecular weight of 246.30 g/mol. Its IUPAC name is N-ethyl-N-methyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;hydron.
| Compound Name | N-ethyl-N-methyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;hydron |
|---|---|
| PubChem CID | 175261981 |
| Molecular Formula | C13H19F3N+ |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | N-ethyl-N-methyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;hydron |
| SMILES | CCN(C)C(C)Cc1cccc(C(F)(F)F)c1.[H+] |
| InChI | InChI=1S/C13H18F3N/c1-4-17(3)10(2)8-11-6-5-7-12(9-11)13(14,15)16/h5-7,9-10H,4,8H2,1-3H3/p+1 |
| InChIKey | KNELLTQVCHKYBM-UHFFFAOYSA-O |
| XLogP | 3.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |