C19H24N6 — CID 77091082
N-benzyl-5-[[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]methyl]pyrimidin-2-amine (PubChem CID 77091082) has the molecular formula C19H24N6 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-benzyl-5-[[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]methyl]pyrimidin-2-amine.
| Compound Name | N-benzyl-5-[[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 77091082 |
| Molecular Formula | C19H24N6 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | N-benzyl-5-[[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]methyl]pyrimidin-2-amine |
| SMILES | CN(CCc1cnn(C)c1)Cc1cnc(NCc2ccccc2)nc1 |
| InChI | InChI=1S/C19H24N6/c1-24(9-8-17-13-23-25(2)15-17)14-18-11-21-19(22-12-18)20-10-16-6-4-3-5-7-16/h3-7,11-13,15H,8-10,14H2,1-2H3,(H,20,21,22) |
| InChIKey | OKZZWQIOOBFKBL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |