C21H17N3O2 — CID 77094774
N,N-bis(pyridin-3-ylmethyl)-1-benzofuran-3-carboxamide (PubChem CID 77094774) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is N,N-bis(pyridin-3-ylmethyl)-1-benzofuran-3-carboxamide.
| Compound Name | N,N-bis(pyridin-3-ylmethyl)-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 77094774 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N,N-bis(pyridin-3-ylmethyl)-1-benzofuran-3-carboxamide |
| SMILES | O=C(c1coc2ccccc12)N(Cc1cccnc1)Cc1cccnc1 |
| InChI | InChI=1S/C21H17N3O2/c25-21(19-15-26-20-8-2-1-7-18(19)20)24(13-16-5-3-9-22-11-16)14-17-6-4-10-23-12-17/h1-12,15H,13-14H2 |
| InChIKey | BYPJOUSEQVQIBZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |