C27H21N3O3 — CID 42786027
N-(1H-imidazol-5-ylmethyl)-4-oxo-N-[(4-phenylphenyl)methyl]chromene-3-carboxamide (PubChem CID 42786027) has the molecular formula C27H21N3O3 and a molecular weight of 435.48 g/mol. Its IUPAC name is N-(1H-imidazol-5-ylmethyl)-4-oxo-N-[(4-phenylphenyl)methyl]chromene-3-carboxamide.
| Compound Name | N-(1H-imidazol-5-ylmethyl)-4-oxo-N-[(4-phenylphenyl)methyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 42786027 |
| Molecular Formula | C27H21N3O3 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-(1H-imidazol-5-ylmethyl)-4-oxo-N-[(4-phenylphenyl)methyl]chromene-3-carboxamide |
| SMILES | O=C(c1coc2ccccc2c1=O)N(Cc1ccc(-c2ccccc2)cc1)Cc1cnc[nH]1 |
| InChI | InChI=1S/C27H21N3O3/c31-26-23-8-4-5-9-25(23)33-17-24(26)27(32)30(16-22-14-28-18-29-22)15-19-10-12-21(13-11-19)20-6-2-1-3-7-20/h1-14,17-18H,15-16H2,(H,28,29) |
| InChIKey | JLPDREUJOKRIMI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |