C16H25ClN4O — CID 77095105
4-chloro-1-methyl-N-[1-(pyrrolidin-1-ylmethyl)cyclohexyl]pyrazole-5-carboxamide (PubChem CID 77095105) has the molecular formula C16H25ClN4O and a molecular weight of 324.86 g/mol. Its IUPAC name is 4-chloro-1-methyl-N-[1-(pyrrolidin-1-ylmethyl)cyclohexyl]pyrazole-5-carboxamide.
| Compound Name | 4-chloro-1-methyl-N-[1-(pyrrolidin-1-ylmethyl)cyclohexyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 77095105 |
| Molecular Formula | C16H25ClN4O |
| Molecular Weight | 324.86 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 4-chloro-1-methyl-N-[1-(pyrrolidin-1-ylmethyl)cyclohexyl]pyrazole-5-carboxamide |
| SMILES | Cn1ncc(Cl)c1C(=O)NC1(CN2CCCC2)CCCCC1 |
| InChI | InChI=1S/C16H25ClN4O/c1-20-14(13(17)11-18-20)15(22)19-16(7-3-2-4-8-16)12-21-9-5-6-10-21/h11H,2-10,12H2,1H3,(H,19,22) |
| InChIKey | KIOYCCOGQCXMIV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.86 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |