C20H28N2O — CID 77096460
1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-pyridin-3-ylpiperidin-4-ol (PubChem CID 77096460) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is 1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-pyridin-3-ylpiperidin-4-ol.
| Compound Name | 1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-pyridin-3-ylpiperidin-4-ol |
|---|---|
| PubChem CID | 77096460 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-pyridin-3-ylpiperidin-4-ol |
| SMILES | CC1(C)[C@H]2CC=C(CN3CCC(O)(c4cccnc4)CC3)[C@@H]1C2 |
| InChI | InChI=1S/C20H28N2O/c1-19(2)16-6-5-15(18(19)12-16)14-22-10-7-20(23,8-11-22)17-4-3-9-21-13-17/h3-5,9,13,16,18,23H,6-8,10-12,14H2,1-2H3/t16-,18-/m0/s1 |
| InChIKey | CLSRVLHCSHQCDE-WMZOPIPTSA-N |
| XLogP | 3.36 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|