C16H23NO4 — CID 77096700
2-methyl-6-[4-(propan-2-yloxymethyl)piperidine-1-carbonyl]pyran-4-one (PubChem CID 77096700) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 2-methyl-6-[4-(propan-2-yloxymethyl)piperidine-1-carbonyl]pyran-4-one.
| Compound Name | 2-methyl-6-[4-(propan-2-yloxymethyl)piperidine-1-carbonyl]pyran-4-one |
|---|---|
| PubChem CID | 77096700 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-methyl-6-[4-(propan-2-yloxymethyl)piperidine-1-carbonyl]pyran-4-one |
| SMILES | Cc1cc(=O)cc(C(=O)N2CCC(COC(C)C)CC2)o1 |
| InChI | InChI=1S/C16H23NO4/c1-11(2)20-10-13-4-6-17(7-5-13)16(19)15-9-14(18)8-12(3)21-15/h8-9,11,13H,4-7,10H2,1-3H3 |
| InChIKey | NCKAIMGDPJRAMD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |