C13H17N3O3S — CID 77099063
3-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-N'-hydroxy-3-phenylpropanimidamide (PubChem CID 77099063) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 3-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-N'-hydroxy-3-phenylpropanimidamide.
| Compound Name | 3-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-N'-hydroxy-3-phenylpropanimidamide |
|---|---|
| PubChem CID | 77099063 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 3-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-N'-hydroxy-3-phenylpropanimidamide |
| SMILES | NC(CC(NC1C=CS(=O)(=O)C1)c1ccccc1)=NO |
| InChI | InChI=1S/C13H17N3O3S/c14-13(16-17)8-12(10-4-2-1-3-5-10)15-11-6-7-20(18,19)9-11/h1-7,11-12,15,17H,8-9H2,(H2,14,16) |
| InChIKey | YIFDHSCJNZSGGM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|