C15H27NO2 — CID 77101116
methyl 2-ethyl-4-(4-ethyl-4-methylpiperidin-1-yl)but-2-enoate (PubChem CID 77101116) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is methyl 2-ethyl-4-(4-ethyl-4-methylpiperidin-1-yl)but-2-enoate.
| Compound Name | methyl 2-ethyl-4-(4-ethyl-4-methylpiperidin-1-yl)but-2-enoate |
|---|---|
| PubChem CID | 77101116 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | methyl 2-ethyl-4-(4-ethyl-4-methylpiperidin-1-yl)but-2-enoate |
| SMILES | CCC(=CCN1CCC(C)(CC)CC1)C(=O)OC |
| InChI | InChI=1S/C15H27NO2/c1-5-13(14(17)18-4)7-10-16-11-8-15(3,6-2)9-12-16/h7H,5-6,8-12H2,1-4H3 |
| InChIKey | YQORAYNNCNIKLR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|