C14H19NO2S — CID 77102405
methyl 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-ethylbut-2-enoate (PubChem CID 77102405) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is methyl 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-ethylbut-2-enoate.
| Compound Name | methyl 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-ethylbut-2-enoate |
|---|---|
| PubChem CID | 77102405 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | methyl 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-ethylbut-2-enoate |
| SMILES | CCC(=CCN1CCc2sccc2C1)C(=O)OC |
| InChI | InChI=1S/C14H19NO2S/c1-3-11(14(16)17-2)4-7-15-8-5-13-12(10-15)6-9-18-13/h4,6,9H,3,5,7-8,10H2,1-2H3 |
| InChIKey | ACZFNNQFODBKKF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|