C23H31N5O2S — CID 77105881
(4aR,7R,8aR)-2-amino-N-ethyl-5-methyl-N-(2-phenylethylcarbamoyl)-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline-7-carboxamide (PubChem CID 77105881) has the molecular formula C23H31N5O2S and a molecular weight of 441.60 g/mol. Its IUPAC name is (4aR,7R,8aR)-2-amino-N-ethyl-5-methyl-N-(2-phenylethylcarbamoyl)-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline-7-carboxamide.
| Compound Name | (4aR,7R,8aR)-2-amino-N-ethyl-5-methyl-N-(2-phenylethylcarbamoyl)-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 77105881 |
| Molecular Formula | C23H31N5O2S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | (4aR,7R,8aR)-2-amino-N-ethyl-5-methyl-N-(2-phenylethylcarbamoyl)-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline-7-carboxamide |
| SMILES | CCN(C(=O)NCCc1ccccc1)C(=O)[C@@H]1C[C@@H]2Cc3nc(N)sc3C[C@H]2N(C)C1 |
| InChI | InChI=1S/C23H31N5O2S/c1-3-28(23(30)25-10-9-15-7-5-4-6-8-15)21(29)17-11-16-12-18-20(31-22(24)26-18)13-19(16)27(2)14-17/h4-8,16-17,19H,3,9-14H2,1-2H3,(H2,24,26)(H,25,30)/t16-,17-,19-/m1/s1 |
| InChIKey | TVFLABRCFOFUBY-ZHALLVOQSA-N |
| XLogP | 2.56 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |